C15H13ClN2O2S — CID 79342532
5-chloro-6-[ethyl(thiophen-2-ylmethyl)amino]-1H-indole-2,3-dione (PubChem CID 79342532) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 5-chloro-6-[ethyl(thiophen-2-ylmethyl)amino]-1H-indole-2,3-dione.
| Compound Name | 5-chloro-6-[ethyl(thiophen-2-ylmethyl)amino]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79342532 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 5-chloro-6-[ethyl(thiophen-2-ylmethyl)amino]-1H-indole-2,3-dione |
| SMILES | CCN(Cc1cccs1)c1cc2c(cc1Cl)C(=O)C(=O)N2 |
| InChI | InChI=1S/C15H13ClN2O2S/c1-2-18(8-9-4-3-5-21-9)13-7-12-10(6-11(13)16)14(19)15(20)17-12/h3-7H,2,8H2,1H3,(H,17,19,20) |
| InChIKey | BLURACIJEGIECA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|