C16H23ClN4 — CID 79343834
N-tert-butyl-3-(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylprop-2-en-1-amine (PubChem CID 79343834) has the molecular formula C16H23ClN4 and a molecular weight of 306.84 g/mol. Its IUPAC name is N-tert-butyl-3-(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylprop-2-en-1-amine.
| Compound Name | N-tert-butyl-3-(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79343834 |
| Molecular Formula | C16H23ClN4 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-tert-butyl-3-(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylprop-2-en-1-amine |
| SMILES | CC(=Cc1cc2c(C)nn(C)c2nc1Cl)CNC(C)(C)C |
| InChI | InChI=1S/C16H23ClN4/c1-10(9-18-16(3,4)5)7-12-8-13-11(2)20-21(6)15(13)19-14(12)17/h7-8,18H,9H2,1-6H3 |
| InChIKey | UPFHXXTXKGVFRW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|