C16H22BrN3O — CID 79344717
5-bromo-3-(ethylamino)-6-[ethyl(2-methylprop-2-enyl)amino]-1,3-dihydroindol-2-one (PubChem CID 79344717) has the molecular formula C16H22BrN3O and a molecular weight of 352.28 g/mol. Its IUPAC name is 5-bromo-3-(ethylamino)-6-[ethyl(2-methylprop-2-enyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-3-(ethylamino)-6-[ethyl(2-methylprop-2-enyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79344717 |
| Molecular Formula | C16H22BrN3O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 5-bromo-3-(ethylamino)-6-[ethyl(2-methylprop-2-enyl)amino]-1,3-dihydroindol-2-one |
| SMILES | C=C(C)CN(CC)c1cc2c(cc1Br)C(NCC)C(=O)N2 |
| InChI | InChI=1S/C16H22BrN3O/c1-5-18-15-11-7-12(17)14(8-13(11)19-16(15)21)20(6-2)9-10(3)4/h7-8,15,18H,3,5-6,9H2,1-2,4H3,(H,19,21) |
| InChIKey | ROSQZMKRSYXUDU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|