C14H20BrN3O — CID 79343471
5-bromo-6-[ethyl(methyl)amino]-3-(propylamino)-1,3-dihydroindol-2-one (PubChem CID 79343471) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 5-bromo-6-[ethyl(methyl)amino]-3-(propylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-6-[ethyl(methyl)amino]-3-(propylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79343471 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 5-bromo-6-[ethyl(methyl)amino]-3-(propylamino)-1,3-dihydroindol-2-one |
| SMILES | CCCNC1C(=O)Nc2cc(N(C)CC)c(Br)cc21 |
| InChI | InChI=1S/C14H20BrN3O/c1-4-6-16-13-9-7-10(15)12(18(3)5-2)8-11(9)17-14(13)19/h7-8,13,16H,4-6H2,1-3H3,(H,17,19) |
| InChIKey | JKRVTCGWGKAGKV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|