C13H15BrN4O — CID 79342790
3-[[5-bromo-3-(methylamino)-2-oxo-1,3-dihydroindol-6-yl]-methylamino]propanenitrile (PubChem CID 79342790) has the molecular formula C13H15BrN4O and a molecular weight of 323.19 g/mol. Its IUPAC name is 3-[[5-bromo-3-(methylamino)-2-oxo-1,3-dihydroindol-6-yl]-methylamino]propanenitrile.
| Compound Name | 3-[[5-bromo-3-(methylamino)-2-oxo-1,3-dihydroindol-6-yl]-methylamino]propanenitrile |
|---|---|
| PubChem CID | 79342790 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-[[5-bromo-3-(methylamino)-2-oxo-1,3-dihydroindol-6-yl]-methylamino]propanenitrile |
| SMILES | CNC1C(=O)Nc2cc(N(C)CCC#N)c(Br)cc21 |
| InChI | InChI=1S/C13H15BrN4O/c1-16-12-8-6-9(14)11(18(2)5-3-4-15)7-10(8)17-13(12)19/h6-7,12,16H,3,5H2,1-2H3,(H,17,19) |
| InChIKey | QBPMHLSUEAHDID-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|