C13H12ClN5O — CID 79349440
2-[[5-chloro-3-(methylamino)-2-oxo-1,3-dihydroindol-6-yl]-(cyanomethyl)amino]acetonitrile (PubChem CID 79349440) has the molecular formula C13H12ClN5O and a molecular weight of 289.73 g/mol. Its IUPAC name is 2-[[5-chloro-3-(methylamino)-2-oxo-1,3-dihydroindol-6-yl]-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[[5-chloro-3-(methylamino)-2-oxo-1,3-dihydroindol-6-yl]-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 79349440 |
| Molecular Formula | C13H12ClN5O |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[[5-chloro-3-(methylamino)-2-oxo-1,3-dihydroindol-6-yl]-(cyanomethyl)amino]acetonitrile |
| SMILES | CNC1C(=O)Nc2cc(N(CC#N)CC#N)c(Cl)cc21 |
| InChI | InChI=1S/C13H12ClN5O/c1-17-12-8-6-9(14)11(7-10(8)18-13(12)20)19(4-2-15)5-3-16/h6-7,12,17H,4-5H2,1H3,(H,18,20) |
| InChIKey | XWQOFSRNXACDTK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|