C12H9ClN4O2 — CID 79336274
2-[(5-chloro-3-hydroxy-2-oxo-1,3-dihydroindol-6-yl)-(cyanomethyl)amino]acetonitrile (PubChem CID 79336274) has the molecular formula C12H9ClN4O2 and a molecular weight of 276.68 g/mol. Its IUPAC name is 2-[(5-chloro-3-hydroxy-2-oxo-1,3-dihydroindol-6-yl)-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[(5-chloro-3-hydroxy-2-oxo-1,3-dihydroindol-6-yl)-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 79336274 |
| Molecular Formula | C12H9ClN4O2 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-[(5-chloro-3-hydroxy-2-oxo-1,3-dihydroindol-6-yl)-(cyanomethyl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)c1cc2c(cc1Cl)C(O)C(=O)N2 |
| InChI | InChI=1S/C12H9ClN4O2/c13-8-5-7-9(16-12(19)11(7)18)6-10(8)17(3-1-14)4-2-15/h5-6,11,18H,3-4H2,(H,16,19) |
| InChIKey | MDBJTHALLDIHJQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|