C14H19ClN2O4 — CID 79345018
6-[bis(2-methoxyethyl)amino]-5-chloro-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 79345018) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is 6-[bis(2-methoxyethyl)amino]-5-chloro-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 6-[bis(2-methoxyethyl)amino]-5-chloro-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79345018 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 6-[bis(2-methoxyethyl)amino]-5-chloro-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | COCCN(CCOC)c1cc2c(cc1Cl)C(O)C(=O)N2 |
| InChI | InChI=1S/C14H19ClN2O4/c1-20-5-3-17(4-6-21-2)12-8-11-9(7-10(12)15)13(18)14(19)16-11/h7-8,13,18H,3-6H2,1-2H3,(H,16,19) |
| InChIKey | ILWIYTKXICFBKQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|