C13H17ClN2O3 — CID 79336490
5-chloro-3-hydroxy-6-[2-hydroxyethyl(propan-2-yl)amino]-1,3-dihydroindol-2-one (PubChem CID 79336490) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 5-chloro-3-hydroxy-6-[2-hydroxyethyl(propan-2-yl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-hydroxy-6-[2-hydroxyethyl(propan-2-yl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79336490 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-chloro-3-hydroxy-6-[2-hydroxyethyl(propan-2-yl)amino]-1,3-dihydroindol-2-one |
| SMILES | CC(C)N(CCO)c1cc2c(cc1Cl)C(O)C(=O)N2 |
| InChI | InChI=1S/C13H17ClN2O3/c1-7(2)16(3-4-17)11-6-10-8(5-9(11)14)12(18)13(19)15-10/h5-7,12,17-18H,3-4H2,1-2H3,(H,15,19) |
| InChIKey | NVAKXFWWPLHLSJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|