C16H23ClN2O2 — CID 79341801
6-[butan-2-yl(butyl)amino]-5-chloro-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 79341801) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 6-[butan-2-yl(butyl)amino]-5-chloro-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 6-[butan-2-yl(butyl)amino]-5-chloro-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79341801 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 6-[butan-2-yl(butyl)amino]-5-chloro-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCCCN(c1cc2c(cc1Cl)C(O)C(=O)N2)C(C)CC |
| InChI | InChI=1S/C16H23ClN2O2/c1-4-6-7-19(10(3)5-2)14-9-13-11(8-12(14)17)15(20)16(21)18-13/h8-10,15,20H,4-7H2,1-3H3,(H,18,21) |
| InChIKey | PFYHMPBFSKRUML-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|