C14H18ClN3O3 — CID 79341794
2-[(5-chloro-3-hydroxy-2-oxo-1,3-dihydroindol-6-yl)-propylamino]-N-methylacetamide (PubChem CID 79341794) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-[(5-chloro-3-hydroxy-2-oxo-1,3-dihydroindol-6-yl)-propylamino]-N-methylacetamide.
| Compound Name | 2-[(5-chloro-3-hydroxy-2-oxo-1,3-dihydroindol-6-yl)-propylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 79341794 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[(5-chloro-3-hydroxy-2-oxo-1,3-dihydroindol-6-yl)-propylamino]-N-methylacetamide |
| SMILES | CCCN(CC(=O)NC)c1cc2c(cc1Cl)C(O)C(=O)N2 |
| InChI | InChI=1S/C14H18ClN3O3/c1-3-4-18(7-12(19)16-2)11-6-10-8(5-9(11)15)13(20)14(21)17-10/h5-6,13,20H,3-4,7H2,1-2H3,(H,16,19)(H,17,21) |
| InChIKey | DBAMWXROTJUKBN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|