C12H15ClN2O3 — CID 79336625
5-chloro-6-[ethyl(2-hydroxyethyl)amino]-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 79336625) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 5-chloro-6-[ethyl(2-hydroxyethyl)amino]-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-6-[ethyl(2-hydroxyethyl)amino]-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79336625 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 5-chloro-6-[ethyl(2-hydroxyethyl)amino]-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCN(CCO)c1cc2c(cc1Cl)C(O)C(=O)N2 |
| InChI | InChI=1S/C12H15ClN2O3/c1-2-15(3-4-16)10-6-9-7(5-8(10)13)11(17)12(18)14-9/h5-6,11,16-17H,2-4H2,1H3,(H,14,18) |
| InChIKey | ROTYYZLLFPWGSW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|