C15H21FN2O3 — CID 80747140
5-fluoro-3-hydroxy-6-[2-hydroxyethyl(pentan-3-yl)amino]-1,3-dihydroindol-2-one (PubChem CID 80747140) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is 5-fluoro-3-hydroxy-6-[2-hydroxyethyl(pentan-3-yl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-hydroxy-6-[2-hydroxyethyl(pentan-3-yl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 80747140 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 5-fluoro-3-hydroxy-6-[2-hydroxyethyl(pentan-3-yl)amino]-1,3-dihydroindol-2-one |
| SMILES | CCC(CC)N(CCO)c1cc2c(cc1F)C(O)C(=O)N2 |
| InChI | InChI=1S/C15H21FN2O3/c1-3-9(4-2)18(5-6-19)13-8-12-10(7-11(13)16)14(20)15(21)17-12/h7-9,14,19-20H,3-6H2,1-2H3,(H,17,21) |
| InChIKey | UVMAXDQQVVQFQE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|