C14H19BrN2O2 — CID 79342125
5-bromo-3-(methylamino)-6-(3-methylbutoxy)-1,3-dihydroindol-2-one (PubChem CID 79342125) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 5-bromo-3-(methylamino)-6-(3-methylbutoxy)-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-3-(methylamino)-6-(3-methylbutoxy)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79342125 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-bromo-3-(methylamino)-6-(3-methylbutoxy)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2cc(OCCC(C)C)c(Br)cc21 |
| InChI | InChI=1S/C14H19BrN2O2/c1-8(2)4-5-19-12-7-11-9(6-10(12)15)13(16-3)14(18)17-11/h6-8,13,16H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | RNWILHBGUHQFNG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |