C15H15BrN2O3 — CID 79342580
5-bromo-3-(ethylamino)-6-(furan-2-ylmethoxy)-1,3-dihydroindol-2-one (PubChem CID 79342580) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is 5-bromo-3-(ethylamino)-6-(furan-2-ylmethoxy)-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-3-(ethylamino)-6-(furan-2-ylmethoxy)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79342580 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 5-bromo-3-(ethylamino)-6-(furan-2-ylmethoxy)-1,3-dihydroindol-2-one |
| SMILES | CCNC1C(=O)Nc2cc(OCc3ccco3)c(Br)cc21 |
| InChI | InChI=1S/C15H15BrN2O3/c1-2-17-14-10-6-11(16)13(7-12(10)18-15(14)19)21-8-9-4-3-5-20-9/h3-7,14,17H,2,8H2,1H3,(H,18,19) |
| InChIKey | HYNZEEYGOFWATQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |