C16H23BrN2O2 — CID 79344214
5-bromo-3-(ethylamino)-6-hexoxy-1,3-dihydroindol-2-one (PubChem CID 79344214) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 5-bromo-3-(ethylamino)-6-hexoxy-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-3-(ethylamino)-6-hexoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79344214 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-bromo-3-(ethylamino)-6-hexoxy-1,3-dihydroindol-2-one |
| SMILES | CCCCCCOc1cc2c(cc1Br)C(NCC)C(=O)N2 |
| InChI | InChI=1S/C16H23BrN2O2/c1-3-5-6-7-8-21-14-10-13-11(9-12(14)17)15(18-4-2)16(20)19-13/h9-10,15,18H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | SXGMYJMEPSEGIB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|