C14H13ClN2O2S — CID 79349392
3-amino-5-chloro-6-(2-thiophen-2-ylethoxy)-1,3-dihydroindol-2-one (PubChem CID 79349392) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is 3-amino-5-chloro-6-(2-thiophen-2-ylethoxy)-1,3-dihydroindol-2-one.
| Compound Name | 3-amino-5-chloro-6-(2-thiophen-2-ylethoxy)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79349392 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-amino-5-chloro-6-(2-thiophen-2-ylethoxy)-1,3-dihydroindol-2-one |
| SMILES | NC1C(=O)Nc2cc(OCCc3cccs3)c(Cl)cc21 |
| InChI | InChI=1S/C14H13ClN2O2S/c15-10-6-9-11(17-14(18)13(9)16)7-12(10)19-4-3-8-2-1-5-20-8/h1-2,5-7,13H,3-4,16H2,(H,17,18) |
| InChIKey | UEUBZNBYLBZEEG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |