C14H22N2 — CID 79351630
4-methyl-3-N-(2,2,3,3-tetramethylcyclopropyl)benzene-1,3-diamine (PubChem CID 79351630) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-methyl-3-N-(2,2,3,3-tetramethylcyclopropyl)benzene-1,3-diamine.
| Compound Name | 4-methyl-3-N-(2,2,3,3-tetramethylcyclopropyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 79351630 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-methyl-3-N-(2,2,3,3-tetramethylcyclopropyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1NC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H22N2/c1-9-6-7-10(15)8-11(9)16-12-13(2,3)14(12,4)5/h6-8,12,16H,15H2,1-5H3 |
| InChIKey | DDFSGWHJJVVZBD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|