C13H13N5O3 — CID 79351982
N-(2-nitrophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide (PubChem CID 79351982) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is N-(2-nitrophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide.
| Compound Name | N-(2-nitrophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 79351982 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-(2-nitrophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])C1Cc2nc[nH]c2CN1 |
| InChI | InChI=1S/C13H13N5O3/c19-13(10-5-9-11(6-14-10)16-7-15-9)17-8-3-1-2-4-12(8)18(20)21/h1-4,7,10,14H,5-6H2,(H,15,16)(H,17,19) |
| InChIKey | GJRGZQNENGWPHH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|