C17H35NO3 — CID 79352097
1-(2-butoxyethoxy)-3-[(2,2,3,3-tetramethylcyclopropyl)methylamino]propan-2-ol (PubChem CID 79352097) has the molecular formula C17H35NO3 and a molecular weight of 301.47 g/mol. Its IUPAC name is 1-(2-butoxyethoxy)-3-[(2,2,3,3-tetramethylcyclopropyl)methylamino]propan-2-ol.
| Compound Name | 1-(2-butoxyethoxy)-3-[(2,2,3,3-tetramethylcyclopropyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 79352097 |
| Molecular Formula | C17H35NO3 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | 1-(2-butoxyethoxy)-3-[(2,2,3,3-tetramethylcyclopropyl)methylamino]propan-2-ol |
| SMILES | CCCCOCCOCC(O)CNCC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C17H35NO3/c1-6-7-8-20-9-10-21-13-14(19)11-18-12-15-16(2,3)17(15,4)5/h14-15,18-19H,6-13H2,1-5H3 |
| InChIKey | YQWSDAZXZCEDNE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|