C16H33NO2 — CID 79357968
1-hexoxy-3-[(2,2,3,3-tetramethylcyclopropyl)amino]propan-2-ol (PubChem CID 79357968) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is 1-hexoxy-3-[(2,2,3,3-tetramethylcyclopropyl)amino]propan-2-ol.
| Compound Name | 1-hexoxy-3-[(2,2,3,3-tetramethylcyclopropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 79357968 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 1-hexoxy-3-[(2,2,3,3-tetramethylcyclopropyl)amino]propan-2-ol |
| SMILES | CCCCCCOCC(O)CNC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H33NO2/c1-6-7-8-9-10-19-12-13(18)11-17-14-15(2,3)16(14,4)5/h13-14,17-18H,6-12H2,1-5H3 |
| InChIKey | HJAQMCVQJGHSHK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|