C13H19F3N4O — CID 79352147
N-butyl-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide (PubChem CID 79352147) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is N-butyl-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide.
| Compound Name | N-butyl-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 79352147 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-butyl-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)C1Cc2nc[nH]c2CN1 |
| InChI | InChI=1S/C13H19F3N4O/c1-2-3-4-20(7-13(14,15)16)12(21)10-5-9-11(6-17-10)19-8-18-9/h8,10,17H,2-7H2,1H3,(H,18,19) |
| InChIKey | XKUPQWFRPOFCKN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |