C13H24N2 — CID 79356808
N'-(2,2,3,3-tetramethylcyclopropyl)cyclopentanecarboximidamide (PubChem CID 79356808) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N'-(2,2,3,3-tetramethylcyclopropyl)cyclopentanecarboximidamide.
| Compound Name | N'-(2,2,3,3-tetramethylcyclopropyl)cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 79356808 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N'-(2,2,3,3-tetramethylcyclopropyl)cyclopentanecarboximidamide |
| SMILES | CC1(C)C(/N=C(\N)C2CCCC2)C1(C)C |
| InChI | InChI=1S/C13H24N2/c1-12(2)11(13(12,3)4)15-10(14)9-7-5-6-8-9/h9,11H,5-8H2,1-4H3,(H2,14,15) |
| InChIKey | JBXHMEQMTCZYJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|