About 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide
6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide (PubChem CID 172957943) has the molecular formula C13H27N3
and a molecular weight of 225.38 g/mol. Its IUPAC name is 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide.
Molecular Properties
| Compound Name | 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide |
| PubChem CID | 172957943 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide |
| SMILES | CN/N=C(\N)C1CCCCC(C)CCCC1 |
| InChI | InChI=1S/C13H27N3/c1-11-7-3-5-9-12(10-6-4-8-11)13(14)16-15-2/h11-12,15H,3-10H2,1-2H3,(H2,14,16) |
| InChIKey | FNAWOUJGNQHWBC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide?
The IUPAC name of 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide (CID 172957943) is 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide.
What is the SMILES notation for 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide?
The canonical SMILES for 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide is CN/N=C(\N)C1CCCCC(C)CCCC1.
What is the InChIKey of 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide?
The InChIKey is FNAWOUJGNQHWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3/c1-11-7-3-5-9-12(10-6-4-8-11)13(14)16-15-2/h11-12,15H,3-10H2,1-2H3,(H2,14,16).
What are the key properties of 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide?
6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide has a molecular weight of 225.38 g/mol, XLogP of 2.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-N'-(methylamino)cyclodecane-1-carboximidamide is sourced from PubChem (CID 172957943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).