C23H30N2O3S — CID 7935740
N-[4-[(2R)-butan-2-yl]phenyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 7935740) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is N-[4-[(2R)-butan-2-yl]phenyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[4-[(2R)-butan-2-yl]phenyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 7935740 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[4-[(2R)-butan-2-yl]phenyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)c2ccc(C)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-4-17(2)19-10-12-21(13-11-19)24-23(26)20-9-8-18(3)22(16-20)29(27,28)25-14-6-5-7-15-25/h8-13,16-17H,4-7,14-15H2,1-3H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | GNIQMRCJXJPNNC-QGZVFWFLSA-N |
| XLogP | 4.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |