C11H11FN4O3 — CID 79367442
2-fluoro-3-hydroxy-3-[3-(tetrazol-1-yl)phenyl]butanoic acid (PubChem CID 79367442) has the molecular formula C11H11FN4O3 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-fluoro-3-hydroxy-3-[3-(tetrazol-1-yl)phenyl]butanoic acid.
| Compound Name | 2-fluoro-3-hydroxy-3-[3-(tetrazol-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 79367442 |
| Molecular Formula | C11H11FN4O3 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-fluoro-3-hydroxy-3-[3-(tetrazol-1-yl)phenyl]butanoic acid |
| SMILES | CC(O)(c1cccc(-n2cnnn2)c1)C(F)C(=O)O |
| InChI | InChI=1S/C11H11FN4O3/c1-11(19,9(12)10(17)18)7-3-2-4-8(5-7)16-6-13-14-15-16/h2-6,9,19H,1H3,(H,17,18) |
| InChIKey | YYHNSMOARWQZLJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |