C10H10N4O3 — CID 61237433
2-hydroxy-2-[3-(tetrazol-1-yl)phenyl]propanoic acid (PubChem CID 61237433) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-hydroxy-2-[3-(tetrazol-1-yl)phenyl]propanoic acid.
| Compound Name | 2-hydroxy-2-[3-(tetrazol-1-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 61237433 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-hydroxy-2-[3-(tetrazol-1-yl)phenyl]propanoic acid |
| SMILES | CC(O)(C(=O)O)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C10H10N4O3/c1-10(17,9(15)16)7-3-2-4-8(5-7)14-6-11-12-13-14/h2-6,17H,1H3,(H,15,16) |
| InChIKey | BDYULSZJKHSFFP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |