C14H18F3NO — CID 79368925
N-[[2-(3,4,5-trifluorophenyl)oxolan-3-yl]methyl]propan-2-amine (PubChem CID 79368925) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is N-[[2-(3,4,5-trifluorophenyl)oxolan-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[2-(3,4,5-trifluorophenyl)oxolan-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 79368925 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[[2-(3,4,5-trifluorophenyl)oxolan-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1CCOC1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H18F3NO/c1-8(2)18-7-9-3-4-19-14(9)10-5-11(15)13(17)12(16)6-10/h5-6,8-9,14,18H,3-4,7H2,1-2H3 |
| InChIKey | PRLWOKCEJIRQNP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|