C12H13F3O2 — CID 79372721
[2-(3,4,5-trifluorophenyl)oxan-3-yl]methanol (PubChem CID 79372721) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is [2-(3,4,5-trifluorophenyl)oxan-3-yl]methanol.
| Compound Name | [2-(3,4,5-trifluorophenyl)oxan-3-yl]methanol |
|---|---|
| PubChem CID | 79372721 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | [2-(3,4,5-trifluorophenyl)oxan-3-yl]methanol |
| SMILES | OCC1CCCOC1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H13F3O2/c13-9-4-8(5-10(14)11(9)15)12-7(6-16)2-1-3-17-12/h4-5,7,12,16H,1-3,6H2 |
| InChIKey | OZRVPXXODBVVFH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|