C8H12N2O2 — CID 79370177
1-(cyanomethyl)-2-methylpyrrolidine-3-carboxylic acid (PubChem CID 79370177) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-(cyanomethyl)-2-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(cyanomethyl)-2-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 79370177 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-(cyanomethyl)-2-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1C(C(=O)O)CCN1CC#N |
| InChI | InChI=1S/C8H12N2O2/c1-6-7(8(11)12)2-4-10(6)5-3-9/h6-7H,2,4-5H2,1H3,(H,11,12) |
| InChIKey | VUKSDRFKVFHMGM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|