C17H18FNO2 — CID 79372156
[1-(3-fluoroanilino)-6-methoxy-2,3-dihydroinden-1-yl]methanol (PubChem CID 79372156) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is [1-(3-fluoroanilino)-6-methoxy-2,3-dihydroinden-1-yl]methanol.
| Compound Name | [1-(3-fluoroanilino)-6-methoxy-2,3-dihydroinden-1-yl]methanol |
|---|---|
| PubChem CID | 79372156 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [1-(3-fluoroanilino)-6-methoxy-2,3-dihydroinden-1-yl]methanol |
| SMILES | COc1ccc2c(c1)C(CO)(Nc1cccc(F)c1)CC2 |
| InChI | InChI=1S/C17H18FNO2/c1-21-15-6-5-12-7-8-17(11-20,16(12)10-15)19-14-4-2-3-13(18)9-14/h2-6,9-10,19-20H,7-8,11H2,1H3 |
| InChIKey | OOSCTEPYTKKBMU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |