C14H17N5O — CID 7937233
(3R)-5-(azepan-1-yl)-2-imino-5-oxopentane-1,1,3-tricarbonitrile (PubChem CID 7937233) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is (3R)-5-(azepan-1-yl)-2-imino-5-oxopentane-1,1,3-tricarbonitrile.
| Compound Name | (3R)-5-(azepan-1-yl)-2-imino-5-oxopentane-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 7937233 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (3R)-5-(azepan-1-yl)-2-imino-5-oxopentane-1,1,3-tricarbonitrile |
| SMILES | [H]/N=C(\C(C#N)C#N)[C@H](C#N)CC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C14H17N5O/c15-8-11(14(18)12(9-16)10-17)7-13(20)19-5-3-1-2-4-6-19/h11-12,18H,1-7H2/b18-14-/t11-/m0/s1 |
| InChIKey | XSSHIFFBWRZCES-WMEZLHQCSA-N |
| XLogP | 1.60 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|