C18H28O2 — CID 79374993
1-(2-ethylhexyl)-6-methoxy-2,3-dihydroinden-1-ol (PubChem CID 79374993) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-6-methoxy-2,3-dihydroinden-1-ol.
| Compound Name | 1-(2-ethylhexyl)-6-methoxy-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 79374993 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-(2-ethylhexyl)-6-methoxy-2,3-dihydroinden-1-ol |
| SMILES | CCCCC(CC)CC1(O)CCc2ccc(OC)cc21 |
| InChI | InChI=1S/C18H28O2/c1-4-6-7-14(5-2)13-18(19)11-10-15-8-9-16(20-3)12-17(15)18/h8-9,12,14,19H,4-7,10-11,13H2,1-3H3 |
| InChIKey | PVTFCKARGFWKEV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |