C14H32N2O — CID 79377227
1-[[2,2-dimethyl-3-(propylamino)propyl]-ethylamino]-2-methylpropan-2-ol (PubChem CID 79377227) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is 1-[[2,2-dimethyl-3-(propylamino)propyl]-ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[2,2-dimethyl-3-(propylamino)propyl]-ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 79377227 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | 1-[[2,2-dimethyl-3-(propylamino)propyl]-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCCNCC(C)(C)CN(CC)CC(C)(C)O |
| InChI | InChI=1S/C14H32N2O/c1-7-9-15-10-13(3,4)11-16(8-2)12-14(5,6)17/h15,17H,7-12H2,1-6H3 |
| InChIKey | MUJGBNJJFHCHOK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|