C11H24N2O3S — CID 79377843
N-ethyl-N-(2-hydroxy-2-methylpropyl)-1-pyrrolidin-2-ylmethanesulfonamide (PubChem CID 79377843) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxy-2-methylpropyl)-1-pyrrolidin-2-ylmethanesulfonamide.
| Compound Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)-1-pyrrolidin-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 79377843 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)-1-pyrrolidin-2-ylmethanesulfonamide |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)CC1CCCN1 |
| InChI | InChI=1S/C11H24N2O3S/c1-4-13(9-11(2,3)14)17(15,16)8-10-6-5-7-12-10/h10,12,14H,4-9H2,1-3H3 |
| InChIKey | JEJLYUWAYUKTRI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |