C14H18F3N3O — CID 79378514
4-[2-amino-4-(trifluoromethyl)anilino]-N-cyclopropylbutanamide (PubChem CID 79378514) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-[2-amino-4-(trifluoromethyl)anilino]-N-cyclopropylbutanamide.
| Compound Name | 4-[2-amino-4-(trifluoromethyl)anilino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 79378514 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-[2-amino-4-(trifluoromethyl)anilino]-N-cyclopropylbutanamide |
| SMILES | Nc1cc(C(F)(F)F)ccc1NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H18F3N3O/c15-14(16,17)9-3-6-12(11(18)8-9)19-7-1-2-13(21)20-10-4-5-10/h3,6,8,10,19H,1-2,4-5,7,18H2,(H,20,21) |
| InChIKey | GGRIVSGOTAXYJX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|