C11H18N4O5S — CID 79379501
5-hydrazinyl-N-(2-hydroxy-2-methylpropyl)-N-methyl-2-nitrobenzenesulfonamide (PubChem CID 79379501) has the molecular formula C11H18N4O5S and a molecular weight of 318.36 g/mol. Its IUPAC name is 5-hydrazinyl-N-(2-hydroxy-2-methylpropyl)-N-methyl-2-nitrobenzenesulfonamide.
| Compound Name | 5-hydrazinyl-N-(2-hydroxy-2-methylpropyl)-N-methyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 79379501 |
| Molecular Formula | C11H18N4O5S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-hydrazinyl-N-(2-hydroxy-2-methylpropyl)-N-methyl-2-nitrobenzenesulfonamide |
| SMILES | CN(CC(C)(C)O)S(=O)(=O)c1cc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N4O5S/c1-11(2,16)7-14(3)21(19,20)10-6-8(13-12)4-5-9(10)15(17)18/h4-6,13,16H,7,12H2,1-3H3 |
| InChIKey | NDJKIWPGHMWWQO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|