C9H21NO3S — CID 79386715
N-ethyl-N-(2-hydroxy-2-methylpropyl)propane-2-sulfonamide (PubChem CID 79386715) has the molecular formula C9H21NO3S and a molecular weight of 223.34 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxy-2-methylpropyl)propane-2-sulfonamide.
| Compound Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 79386715 |
| Molecular Formula | C9H21NO3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-ethyl-N-(2-hydroxy-2-methylpropyl)propane-2-sulfonamide |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C9H21NO3S/c1-6-10(7-9(4,5)11)14(12,13)8(2)3/h8,11H,6-7H2,1-5H3 |
| InChIKey | XOQXXXKEADNOJQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |