C11H21NO3 — CID 79387617
4-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2-methylbut-2-enoic acid (PubChem CID 79387617) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2-methylbut-2-enoic acid.
| Compound Name | 4-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 79387617 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 4-[ethyl-(2-hydroxy-2-methylpropyl)amino]-2-methylbut-2-enoic acid |
| SMILES | CCN(CC=C(C)C(=O)O)CC(C)(C)O |
| InChI | InChI=1S/C11H21NO3/c1-5-12(8-11(3,4)15)7-6-9(2)10(13)14/h6,15H,5,7-8H2,1-4H3,(H,13,14) |
| InChIKey | NNDAIHMZKVQRSY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|