C12H12Cl2N4OS — CID 79388665
N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-methylpyrrolidine-3-carboxamide (PubChem CID 79388665) has the molecular formula C12H12Cl2N4OS and a molecular weight of 331.23 g/mol. Its IUPAC name is N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-methylpyrrolidine-3-carboxamide.
| Compound Name | N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 79388665 |
| Molecular Formula | C12H12Cl2N4OS |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2-methylpyrrolidine-3-carboxamide |
| SMILES | CC1NCCC1C(=O)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C12H12Cl2N4OS/c1-5-6(2-3-15-5)12(19)16-9-7(13)4-8(14)10-11(9)18-20-17-10/h4-6,15H,2-3H2,1H3,(H,16,19) |
| InChIKey | ITNJUEONALERAK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |