C14H21ClN2 — CID 79396925
1-(5-chloro-2-methylphenyl)-2,3-dimethylpiperidin-4-amine (PubChem CID 79396925) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-2,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-2,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 79396925 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-2,3-dimethylpiperidin-4-amine |
| SMILES | Cc1ccc(Cl)cc1N1CCC(N)C(C)C1C |
| InChI | InChI=1S/C14H21ClN2/c1-9-4-5-12(15)8-14(9)17-7-6-13(16)10(2)11(17)3/h4-5,8,10-11,13H,6-7,16H2,1-3H3 |
| InChIKey | PGYSRQXIMSOEPX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |