C10H8BrNOS2 — CID 79399117
4-bromo-2-(2-methylsulfanylphenoxy)-1,3-thiazole (PubChem CID 79399117) has the molecular formula C10H8BrNOS2 and a molecular weight of 302.22 g/mol. Its IUPAC name is 4-bromo-2-(2-methylsulfanylphenoxy)-1,3-thiazole.
| Compound Name | 4-bromo-2-(2-methylsulfanylphenoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 79399117 |
| Molecular Formula | C10H8BrNOS2 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 300.92 |
| IUPAC Name | 4-bromo-2-(2-methylsulfanylphenoxy)-1,3-thiazole |
| SMILES | CSc1ccccc1Oc1nc(Br)cs1 |
| InChI | InChI=1S/C10H8BrNOS2/c1-14-8-5-3-2-4-7(8)13-10-12-9(11)6-15-10/h2-6H,1H3 |
| InChIKey | CWLOGDUPXGBXFT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |