About [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine
[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine (PubChem CID 79400151) has the molecular formula C9H14BrN3S
and a molecular weight of 276.20 g/mol. Its IUPAC name is [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine |
| PubChem CID | 79400151 |
| Molecular Formula | C9H14BrN3S |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine |
| SMILES | NCC1CCN(c2nc(Br)cs2)CC1 |
| InChI | InChI=1S/C9H14BrN3S/c10-8-6-14-9(12-8)13-3-1-7(5-11)2-4-13/h6-7H,1-5,11H2 |
| InChIKey | SSAKMVPOPMQVPE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine?
The IUPAC name of [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine (CID 79400151) is [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine.
What is the SMILES notation for [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine?
The canonical SMILES for [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine is NCC1CCN(c2nc(Br)cs2)CC1.
What is the InChIKey of [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine?
The InChIKey is SSAKMVPOPMQVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrN3S/c10-8-6-14-9(12-8)13-3-1-7(5-11)2-4-13/h6-7H,1-5,11H2.
What are the key properties of [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine?
[1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine has a molecular weight of 276.20 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromo-1,3-thiazol-2-yl)piperidin-4-yl]methanamine is sourced from PubChem (CID 79400151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).