C12H9ClF3N — CID 79404782
2-[chloro-(2,4,6-trifluorophenyl)methylidene]pentanenitrile (PubChem CID 79404782) has the molecular formula C12H9ClF3N and a molecular weight of 259.66 g/mol. Its IUPAC name is 2-[chloro-(2,4,6-trifluorophenyl)methylidene]pentanenitrile.
| Compound Name | 2-[chloro-(2,4,6-trifluorophenyl)methylidene]pentanenitrile |
|---|---|
| PubChem CID | 79404782 |
| Molecular Formula | C12H9ClF3N |
| Molecular Weight | 259.66 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-[chloro-(2,4,6-trifluorophenyl)methylidene]pentanenitrile |
| SMILES | CCCC(C#N)=C(Cl)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H9ClF3N/c1-2-3-7(6-17)12(13)11-9(15)4-8(14)5-10(11)16/h4-5H,2-3H2,1H3 |
| InChIKey | AQZRDBXQNYSSDS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|