C15H26N2S — CID 79406850
N,2,3-trimethyl-1-(1-thiophen-2-ylpropyl)piperidin-4-amine (PubChem CID 79406850) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is N,2,3-trimethyl-1-(1-thiophen-2-ylpropyl)piperidin-4-amine.
| Compound Name | N,2,3-trimethyl-1-(1-thiophen-2-ylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 79406850 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N,2,3-trimethyl-1-(1-thiophen-2-ylpropyl)piperidin-4-amine |
| SMILES | CCC(c1cccs1)N1CCC(NC)C(C)C1C |
| InChI | InChI=1S/C15H26N2S/c1-5-14(15-7-6-10-18-15)17-9-8-13(16-4)11(2)12(17)3/h6-7,10-14,16H,5,8-9H2,1-4H3 |
| InChIKey | BJIUBCWJFZBVOY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |