C14H24N2S — CID 64946281
2,5,5-trimethyl-1-(1-thiophen-2-ylpropyl)piperazine (PubChem CID 64946281) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is 2,5,5-trimethyl-1-(1-thiophen-2-ylpropyl)piperazine.
| Compound Name | 2,5,5-trimethyl-1-(1-thiophen-2-ylpropyl)piperazine |
|---|---|
| PubChem CID | 64946281 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2,5,5-trimethyl-1-(1-thiophen-2-ylpropyl)piperazine |
| SMILES | CCC(c1cccs1)N1CC(C)(C)NCC1C |
| InChI | InChI=1S/C14H24N2S/c1-5-12(13-7-6-8-17-13)16-10-14(3,4)15-9-11(16)2/h6-8,11-12,15H,5,9-10H2,1-4H3 |
| InChIKey | HMOBAQQEQGBRLI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |