C18H32N2S — CID 64946680
2,5,5-triethyl-1-(1-thiophen-2-ylbutyl)piperazine (PubChem CID 64946680) has the molecular formula C18H32N2S and a molecular weight of 308.53 g/mol. Its IUPAC name is 2,5,5-triethyl-1-(1-thiophen-2-ylbutyl)piperazine.
| Compound Name | 2,5,5-triethyl-1-(1-thiophen-2-ylbutyl)piperazine |
|---|---|
| PubChem CID | 64946680 |
| Molecular Formula | C18H32N2S |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2,5,5-triethyl-1-(1-thiophen-2-ylbutyl)piperazine |
| SMILES | CCCC(c1cccs1)N1CC(CC)(CC)NCC1CC |
| InChI | InChI=1S/C18H32N2S/c1-5-10-16(17-11-9-12-21-17)20-14-18(7-3,8-4)19-13-15(20)6-2/h9,11-12,15-16,19H,5-8,10,13-14H2,1-4H3 |
| InChIKey | INYLVRHIIQVHJC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |