C16H28N2S — CID 64862344
2,5,5-triethyl-1-(2-thiophen-2-ylethyl)piperazine (PubChem CID 64862344) has the molecular formula C16H28N2S and a molecular weight of 280.48 g/mol. Its IUPAC name is 2,5,5-triethyl-1-(2-thiophen-2-ylethyl)piperazine.
| Compound Name | 2,5,5-triethyl-1-(2-thiophen-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 64862344 |
| Molecular Formula | C16H28N2S |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2,5,5-triethyl-1-(2-thiophen-2-ylethyl)piperazine |
| SMILES | CCC1CNC(CC)(CC)CN1CCc1cccs1 |
| InChI | InChI=1S/C16H28N2S/c1-4-14-12-17-16(5-2,6-3)13-18(14)10-9-15-8-7-11-19-15/h7-8,11,14,17H,4-6,9-10,12-13H2,1-3H3 |
| InChIKey | SKBHIPUCMKDWON-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |