About 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine
1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine (PubChem CID 106172740) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine.
Molecular Properties
| Compound Name | 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine |
| PubChem CID | 106172740 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine |
| SMILES | CCC1CNC(CC)(CC)CN1CCC1=CCCC1 |
| InChI | InChI=1S/C17H32N2/c1-4-16-13-18-17(5-2,6-3)14-19(16)12-11-15-9-7-8-10-15/h9,16,18H,4-8,10-14H2,1-3H3 |
| InChIKey | DKTSNKVGZUNCKM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine?
The IUPAC name of 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine (CID 106172740) is 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine.
What is the SMILES notation for 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine?
The canonical SMILES for 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine is CCC1CNC(CC)(CC)CN1CCC1=CCCC1.
What is the InChIKey of 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine?
The InChIKey is DKTSNKVGZUNCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2/c1-4-16-13-18-17(5-2,6-3)14-19(16)12-11-15-9-7-8-10-15/h9,16,18H,4-8,10-14H2,1-3H3.
What are the key properties of 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine?
1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine has a molecular weight of 264.46 g/mol, XLogP of 3.73, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(cyclopenten-1-yl)ethyl]-2,5,5-triethylpiperazine is sourced from PubChem (CID 106172740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).