C17H26F2N2 — CID 114934626
1-[(2,6-difluorophenyl)methyl]-2,5,5-triethylpiperazine (PubChem CID 114934626) has the molecular formula C17H26F2N2 and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-2,5,5-triethylpiperazine.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-2,5,5-triethylpiperazine |
|---|---|
| PubChem CID | 114934626 |
| Molecular Formula | C17H26F2N2 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-2,5,5-triethylpiperazine |
| SMILES | CCC1CNC(CC)(CC)CN1Cc1c(F)cccc1F |
| InChI | InChI=1S/C17H26F2N2/c1-4-13-10-20-17(5-2,6-3)12-21(13)11-14-15(18)8-7-9-16(14)19/h7-9,13,20H,4-6,10-12H2,1-3H3 |
| InChIKey | NHYVXUWKRNYYCS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |